C5H9N5 — CID 13628
6-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 13628) has the molecular formula C5H9N5 and a molecular weight of 139.16 g/mol. Its IUPAC name is 6-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 13628 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 6-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C5H9N5/c1-2-3-8-4(6)10-5(7)9-3/h2H2,1H3,(H4,6,7,8,9,10) |
| InChIKey | NAMCDLUESQLMOZ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |