C17H27NO2 — CID 1363274
4-[(2S,5R)-5-(4-methylphenoxy)hexan-2-yl]morpholine (PubChem CID 1363274) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-[(2S,5R)-5-(4-methylphenoxy)hexan-2-yl]morpholine.
| Compound Name | 4-[(2S,5R)-5-(4-methylphenoxy)hexan-2-yl]morpholine |
|---|---|
| PubChem CID | 1363274 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 4-[(2S,5R)-5-(4-methylphenoxy)hexan-2-yl]morpholine |
| SMILES | Cc1ccc(O[C@H](C)CC[C@H](C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-14-4-8-17(9-5-14)20-16(3)7-6-15(2)18-10-12-19-13-11-18/h4-5,8-9,15-16H,6-7,10-13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | GJFRILIBKQXQBC-JKSUJKDBSA-N |
| XLogP | 3.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |