C17H18BrNO3 — CID 1363313
2-(4-bromo-2-methylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 1363313) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(4-bromo-2-methylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1363313 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-(4-bromo-2-methylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)COc1ccc(Br)cc1C |
| InChI | InChI=1S/C17H18BrNO3/c1-11-4-6-16(21-3)14(8-11)19-17(20)10-22-15-7-5-13(18)9-12(15)2/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | MTNRPOKCZMGQHF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |