About N-benzyl-5-methyl-1,3-oxathiolan-2-imine
N-benzyl-5-methyl-1,3-oxathiolan-2-imine (PubChem CID 13634205) has the molecular formula C11H13NOS
and a molecular weight of 207.29 g/mol. Its IUPAC name is N-benzyl-5-methyl-1,3-oxathiolan-2-imine.
Molecular Properties
| Compound Name | N-benzyl-5-methyl-1,3-oxathiolan-2-imine |
| PubChem CID | 13634205 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | N-benzyl-5-methyl-1,3-oxathiolan-2-imine |
| SMILES | CC1CSC(=NCC2=CC=CC=C2)O1 |
| InChI | InChI=1S/C11H13NOS/c1-9-8-14-11(13-9)12-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3 |
| InChIKey | KRLPSHCJGNIHBJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 211 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-5-methyl-1,3-oxathiolan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-methyl-1,3-oxathiolan-2-imine?
The IUPAC name of N-benzyl-5-methyl-1,3-oxathiolan-2-imine (CID 13634205) is N-benzyl-5-methyl-1,3-oxathiolan-2-imine.
What is the SMILES notation for N-benzyl-5-methyl-1,3-oxathiolan-2-imine?
The canonical SMILES for N-benzyl-5-methyl-1,3-oxathiolan-2-imine is CC1CSC(=NCC2=CC=CC=C2)O1.
What is the InChIKey of N-benzyl-5-methyl-1,3-oxathiolan-2-imine?
The InChIKey is KRLPSHCJGNIHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-9-8-14-11(13-9)12-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3.
What are the key properties of N-benzyl-5-methyl-1,3-oxathiolan-2-imine?
N-benzyl-5-methyl-1,3-oxathiolan-2-imine has a molecular weight of 207.29 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-methyl-1,3-oxathiolan-2-imine is sourced from PubChem (CID 13634205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).