C18H10Cl2N2O2S — CID 1363553
2-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione (PubChem CID 1363553) has the molecular formula C18H10Cl2N2O2S and a molecular weight of 389.26 g/mol. Its IUPAC name is 2-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1363553 |
| Molecular Formula | C18H10Cl2N2O2S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C18H10Cl2N2O2S/c19-11-5-6-15(20)10(7-11)8-12-9-21-18(25-12)22-16(23)13-3-1-2-4-14(13)17(22)24/h1-7,9H,8H2 |
| InChIKey | HWXQOEWCKKPLAN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|