About 2-hydroxybenzohydrazide
2-hydroxybenzohydrazide (PubChem CID 13637) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-hydroxybenzohydrazide.
Molecular Properties
| Compound Name | 2-hydroxybenzohydrazide |
| PubChem CID | 13637 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-hydroxybenzohydrazide |
| SMILES | NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C7H8N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h1-4,10H,8H2,(H,9,11) |
| InChIKey | XSXYESVZDBAKKT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzohydrazide?
The IUPAC name of 2-hydroxybenzohydrazide (CID 13637) is 2-hydroxybenzohydrazide.
What is the SMILES notation for 2-hydroxybenzohydrazide?
The canonical SMILES for 2-hydroxybenzohydrazide is NNC(=O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzohydrazide?
The InChIKey is XSXYESVZDBAKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h1-4,10H,8H2,(H,9,11).
What are the key properties of 2-hydroxybenzohydrazide?
2-hydroxybenzohydrazide has a molecular weight of 152.15 g/mol, XLogP of -0.00, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzohydrazide is sourced from PubChem (CID 13637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).