About 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate
4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate (PubChem CID 13643745) has the molecular formula C22H23NO2
and a molecular weight of 333.40 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(4-ethylcyclohexyl)benzoate.
Molecular Properties
| Compound Name | 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate |
| PubChem CID | 13643745 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (4-cyanophenyl) 4-(4-ethylcyclohexyl)benzoate |
| SMILES | CCC1CCC(CC1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C#N |
| InChI | InChI=1S/C22H23NO2/c1-2-16-3-7-18(8-4-16)19-9-11-20(12-10-19)22(24)25-21-13-5-17(15-23)6-14-21/h5-6,9-14,16,18H,2-4,7-8H2,1H3 |
| InChIKey | QSXYPHAWOSQCHP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 50.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 470 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate?
The IUPAC name of 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate (CID 13643745) is (4-cyanophenyl) 4-(4-ethylcyclohexyl)benzoate.
What is the SMILES notation for 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate?
The canonical SMILES for 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate is CCC1CCC(CC1)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C#N.
What is the InChIKey of 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate?
The InChIKey is QSXYPHAWOSQCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2/c1-2-16-3-7-18(8-4-16)19-9-11-20(12-10-19)22(24)25-21-13-5-17(15-23)6-14-21/h5-6,9-14,16,18H,2-4,7-8H2,1H3.
What are the key properties of 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate?
4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate has a molecular weight of 333.40 g/mol, XLogP of 6.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Cyanophenyl 4-trans-(4-ethylcyclohexyl)benzoate is sourced from PubChem (CID 13643745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).