C18H17FN4O5S — CID 136462589
methyl N-[N'-[4-(4-fluorophenyl)sulfanyl-2-formamidophenyl]-N-methoxycarbonylcarbamimidoyl]carbamate (PubChem CID 136462589) has the molecular formula C18H17FN4O5S and a molecular weight of 420.40 g/mol. Its IUPAC name is methyl N-[N'-[4-(4-fluorophenyl)sulfanyl-2-formamidophenyl]-N-methoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | methyl N-[N'-[4-(4-fluorophenyl)sulfanyl-2-formamidophenyl]-N-methoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 136462589 |
| Molecular Formula | C18H17FN4O5S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | methyl N-[N'-[4-(4-fluorophenyl)sulfanyl-2-formamidophenyl]-N-methoxycarbonylcarbamimidoyl]carbamate |
| SMILES | COC(=O)NC(=NC1=C(C=C(C=C1)SC2=CC=C(C=C2)F)NC=O)NC(=O)OC |
| InChI | InChI=1S/C18H17FN4O5S/c1-27-17(25)22-16(23-18(26)28-2)21-14-8-7-13(9-15(14)20-10-24)29-12-5-3-11(19)4-6-12/h3-10H,1-2H3,(H,20,24)(H2,21,22,23,25,26) |
| InChIKey | SNHYIZQYMCKVNJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | 581 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|