About naphthalene-1,2-diamine
naphthalene-1,2-diamine (PubChem CID 13648) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is naphthalene-1,2-diamine.
Molecular Properties
| Compound Name | naphthalene-1,2-diamine |
| PubChem CID | 13648 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | naphthalene-1,2-diamine |
| SMILES | Nc1ccc2ccccc2c1N |
| InChI | InChI=1S/C10H10N2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H,11-12H2 |
| InChIKey | NTNWKDHZTDQSST-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,2-diamine?
The IUPAC name of naphthalene-1,2-diamine (CID 13648) is naphthalene-1,2-diamine.
What is the SMILES notation for naphthalene-1,2-diamine?
The canonical SMILES for naphthalene-1,2-diamine is Nc1ccc2ccccc2c1N.
What is the InChIKey of naphthalene-1,2-diamine?
The InChIKey is NTNWKDHZTDQSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H,11-12H2.
What are the key properties of naphthalene-1,2-diamine?
naphthalene-1,2-diamine has a molecular weight of 158.20 g/mol, XLogP of 2.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,2-diamine is sourced from PubChem (CID 13648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).