C21H25N5O — CID 136500307
5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-imidazol-4-ol (PubChem CID 136500307) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-imidazol-4-ol.
| Compound Name | 5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-imidazol-4-ol |
|---|---|
| PubChem CID | 136500307 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)-2-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-imidazol-4-ol |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1nc(O)c(C=C3C=Nc4ncccc43)[nH]1)C2(C)C |
| InChI | InChI=1S/C21H25N5O/c1-11-15-8-13(21(15,2)3)9-16(11)24-20-25-17(19(27)26-20)7-12-10-23-18-14(12)5-4-6-22-18/h4-7,10-11,13,15-16,27H,8-9H2,1-3H3,(H2,24,25,26)/t11-,13+,15-,16-/m1/s1 |
| InChIKey | UGWTXWGRELUEOD-WXYCVUISSA-N |
| XLogP | 4.25 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |