C20H31F3NO+ — CID 136500989
N-[5-ethenyl-3-methyl-7-(trifluoromethyl)nona-6,8-dienyl]-N-ethylpentanamide (PubChem CID 136500989) has the molecular formula C20H31F3NO+ and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[5-ethenyl-3-methyl-7-(trifluoromethyl)nona-6,8-dienyl]-N-ethylpentanamide.
| Compound Name | N-[5-ethenyl-3-methyl-7-(trifluoromethyl)nona-6,8-dienyl]-N-ethylpentanamide |
|---|---|
| PubChem CID | 136500989 |
| Molecular Formula | C20H31F3NO+ |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[5-ethenyl-3-methyl-7-(trifluoromethyl)nona-6,8-dienyl]-N-ethylpentanamide |
| SMILES | C=CC(=C[C+](C=C)CC(C)CCN(CC)C(=O)CCCC)C(F)(F)F |
| InChI | InChI=1S/C20H31F3NO/c1-6-10-11-19(25)24(9-4)13-12-16(5)14-17(7-2)15-18(8-3)20(21,22)23/h7-8,15-16H,2-3,6,9-14H2,1,4-5H3/q+1 |
| InChIKey | DGOTZFNTXVIBPG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|