C15H15N7O2S — CID 136501296
cyano-[3-(5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]methanesulfinic acid (PubChem CID 136501296) has the molecular formula C15H15N7O2S and a molecular weight of 357.40 g/mol. Its IUPAC name is cyano-[3-(5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]methanesulfinic acid.
| Compound Name | cyano-[3-(5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 136501296 |
| Molecular Formula | C15H15N7O2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | cyano-[3-(5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]methanesulfinic acid |
| SMILES | N#CC(N1CCCC(c2[nH]cnc3nnc4nccc4c23)C1)S(=O)O |
| InChI | InChI=1S/C15H15N7O2S/c16-6-11(25(23)24)22-5-1-2-9(7-22)13-12-10-3-4-17-14(10)20-21-15(12)19-8-18-13/h3-4,8-9,11H,1-2,5,7H2,(H,23,24)(H,18,19,21) |
| InChIKey | XOHZNKREYLUCQT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|