C30H31N5O5 — CID 136501843
N-[2-[2-[5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]ethoxy]ethyl]benzamide (PubChem CID 136501843) has the molecular formula C30H31N5O5 and a molecular weight of 541.61 g/mol. Its IUPAC name is N-[2-[2-[5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 136501843 |
| Molecular Formula | C30H31N5O5 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-[2-[2-[5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]ethoxy]ethyl]benzamide |
| SMILES | CC(C)c1cc(-c2n[nH]c(=O)n2-c2ccc3c(ccn3CCOCCNC(=O)c3ccccc3)c2)c(O)cc1O |
| InChI | InChI=1S/C30H31N5O5/c1-19(2)23-17-24(27(37)18-26(23)36)28-32-33-30(39)35(28)22-8-9-25-21(16-22)10-12-34(25)13-15-40-14-11-31-29(38)20-6-4-3-5-7-20/h3-10,12,16-19,36-37H,11,13-15H2,1-2H3,(H,31,38)(H,33,39) |
| InChIKey | BKIDVABOPCZJPF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|