C28H34N6O7 — CID 136502210
methyl (2S,3S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[[(1R)-3-methoxy-3-oxo-1-phenylpropyl]amino]-2-oxoethyl]amino]-3-methylpentanoate (PubChem CID 136502210) has the molecular formula C28H34N6O7 and a molecular weight of 566.62 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[[(1R)-3-methoxy-3-oxo-1-phenylpropyl]amino]-2-oxoethyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[[(1R)-3-methoxy-3-oxo-1-phenylpropyl]amino]-2-oxoethyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 136502210 |
| Molecular Formula | C28H34N6O7 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | methyl (2S,3S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[[(1R)-3-methoxy-3-oxo-1-phenylpropyl]amino]-2-oxoethyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)N(CC(=O)N[C@H](CC(=O)OC)c1ccccc1)C(=O)c1cc(NC(C)=O)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C28H34N6O7/c1-6-17(2)26(28(39)41-5)34(27(38)21-14-20(30-18(3)35)12-13-22(21)32-33-29)16-24(36)31-23(15-25(37)40-4)19-10-8-7-9-11-19/h7-14,17,23,26H,6,15-16H2,1-5H3,(H,30,35)(H,31,36)/t17-,23+,26-/m0/s1 |
| InChIKey | KGMDEGJEFDKWOV-VPWGAPMNSA-N |
| XLogP | 4.04 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|