C17H23F3N8O2S — CID 136502253
N-[5-[(4,5-diamino-1-methylimidazol-2-yl)diazenyl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 136502253) has the molecular formula C17H23F3N8O2S and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[5-[(4,5-diamino-1-methylimidazol-2-yl)diazenyl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[5-[(4,5-diamino-1-methylimidazol-2-yl)diazenyl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 136502253 |
| Molecular Formula | C17H23F3N8O2S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[5-[(4,5-diamino-1-methylimidazol-2-yl)diazenyl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC1N(C)c2cc(NS(=O)(=O)C(F)(F)F)c(/N=N/c3nc(N)c(N)n3C)cc2C1(C)C |
| InChI | InChI=1S/C17H23F3N8O2S/c1-8-16(2,3)9-6-10(24-25-15-23-13(21)14(22)28(15)5)11(7-12(9)27(8)4)26-31(29,30)17(18,19)20/h6-8,26H,21-22H2,1-5H3/b25-24+ |
| InChIKey | RTCDLOGMPKDVHI-OCOZRVBESA-N |
| XLogP | 3.38 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|