C29H43N3O3 — CID 136502344
1-butanoyl-3-hydroxy-4-[N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-C-(4-phenylbutyl)carbonimidoyl]-2H-pyrrol-5-one (PubChem CID 136502344) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is 1-butanoyl-3-hydroxy-4-[N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-C-(4-phenylbutyl)carbonimidoyl]-2H-pyrrol-5-one.
| Compound Name | 1-butanoyl-3-hydroxy-4-[N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-C-(4-phenylbutyl)carbonimidoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 136502344 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 1-butanoyl-3-hydroxy-4-[N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-C-(4-phenylbutyl)carbonimidoyl]-2H-pyrrol-5-one |
| SMILES | CCCC(=O)N1CC(O)=C(/C(CCCCc2ccccc2)=N/C2CC(C)(C)N(C)C(C)(C)C2)C1=O |
| InChI | InChI=1S/C29H43N3O3/c1-7-13-25(34)32-20-24(33)26(27(32)35)23(17-12-11-16-21-14-9-8-10-15-21)30-22-18-28(2,3)31(6)29(4,5)19-22/h8-10,14-15,22,33H,7,11-13,16-20H2,1-6H3/b30-23+ |
| InChIKey | FXUOVZQPYPWYKG-JJKYIXSRSA-N |
| XLogP | 5.47 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|