2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid

C10H7NO3S — CID 136502408

IUPAC2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid
SMILESO=C(O)c1cc(-c2nccs2)ccc1O
InChIInChI=1S/C10H7NO3S/c12-8-2-1-6(5-7(8)10(13)14)9-11-3-4-15-9/h1-5,12H,(H,13,14)
InChIKeyIMOUAMZPDXQROS-UHFFFAOYSA-N
MW221.24 g/mol
LogP2.21
Rot. Bonds2

About 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid

2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid (PubChem CID 136502408) has the molecular formula C10H7NO3S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid.

Molecular Properties

Compound Name2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid
PubChem CID136502408
Molecular FormulaC10H7NO3S
Molecular Weight221.24 g/mol
Exact Mass221.01
IUPAC Name2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid
SMILESO=C(O)c1cc(-c2nccs2)ccc1O
InChIInChI=1S/C10H7NO3S/c12-8-2-1-6(5-7(8)10(13)14)9-11-3-4-15-9/h1-5,12H,(H,13,14)
InChIKeyIMOUAMZPDXQROS-UHFFFAOYSA-N
XLogP2.21
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.24
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid?
The IUPAC name of 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid (CID 136502408) is 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid.
What is the SMILES notation for 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid?
The canonical SMILES for 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid is O=C(O)c1cc(-c2nccs2)ccc1O.
What is the InChIKey of 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid?
The InChIKey is IMOUAMZPDXQROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3S/c12-8-2-1-6(5-7(8)10(13)14)9-11-3-4-15-9/h1-5,12H,(H,13,14).
What are the key properties of 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid?
2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid has a molecular weight of 221.24 g/mol, XLogP of 2.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-(1,3-thiazol-2-yl)benzoic acid is sourced from PubChem (CID 136502408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).