C47H29N5O2 — CID 136502665
7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-hydroxyquinolin-5-yl)anthracen-9-yl]quinolin-8-ol (PubChem CID 136502665) has the molecular formula C47H29N5O2 and a molecular weight of 695.78 g/mol. Its IUPAC name is 7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-hydroxyquinolin-5-yl)anthracen-9-yl]quinolin-8-ol.
| Compound Name | 7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-hydroxyquinolin-5-yl)anthracen-9-yl]quinolin-8-ol |
|---|---|
| PubChem CID | 136502665 |
| Molecular Formula | C47H29N5O2 |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | 7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-hydroxyquinolin-5-yl)anthracen-9-yl]quinolin-8-ol |
| SMILES | Oc1c(-c2c3ccccc3c(-c3ccc(O)c4ncccc34)c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc23)ccc2cccnc12 |
| InChI | InChI=1S/C47H29N5O2/c53-39-24-23-34(36-18-10-26-49-43(36)39)40-32-16-7-8-17-33(32)41(37-22-19-28-15-9-25-48-42(28)44(37)54)38-27-31(20-21-35(38)40)47-51-45(29-11-3-1-4-12-29)50-46(52-47)30-13-5-2-6-14-30/h1-27,53-54H |
| InChIKey | MYIRXCLHHSMTKV-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|