C48H36N4O — CID 136502741
5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]quinolin-8-ol (PubChem CID 136502741) has the molecular formula C48H36N4O and a molecular weight of 684.84 g/mol. Its IUPAC name is 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]quinolin-8-ol.
| Compound Name | 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]quinolin-8-ol |
|---|---|
| PubChem CID | 136502741 |
| Molecular Formula | C48H36N4O |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]quinolin-8-ol |
| SMILES | CC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2cc3c(cc21)-c1ccc(-c2ccc(O)c4ncccc24)cc1C3(C)C |
| InChI | InChI=1S/C48H36N4O/c1-47(2)38-24-30(32-21-22-42(53)43-35(32)16-11-23-49-43)17-19-33(38)36-26-41-37(27-40(36)47)34-20-18-31(25-39(34)48(41,3)4)46-51-44(28-12-7-5-8-13-28)50-45(52-46)29-14-9-6-10-15-29/h5-27,53H,1-4H3 |
| InChIKey | DXBAHUFNSLQTOO-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |