C11H13N5O — CID 136502815
6-(2-methylpropyl)-3-pyrimidin-2-yl-4H-1,2,4-triazin-5-one (PubChem CID 136502815) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 6-(2-methylpropyl)-3-pyrimidin-2-yl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(2-methylpropyl)-3-pyrimidin-2-yl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136502815 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 6-(2-methylpropyl)-3-pyrimidin-2-yl-4H-1,2,4-triazin-5-one |
| SMILES | CC(C)Cc1nnc(-c2ncccn2)[nH]c1=O |
| InChI | InChI=1S/C11H13N5O/c1-7(2)6-8-11(17)14-10(16-15-8)9-12-4-3-5-13-9/h3-5,7H,6H2,1-2H3,(H,14,16,17) |
| InChIKey | SUABECJANMZJNK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |