C14H22N2O2S — CID 136503065
2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-thiazolidin-4-one (PubChem CID 136503065) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136503065 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC(C)(O)C1(C)S/C(=N/[C@H]2C[C@@H]3CCC2C3)NC1=O |
| InChI | InChI=1S/C14H22N2O2S/c1-13(2,18)14(3)11(17)16-12(19-14)15-10-7-8-4-5-9(10)6-8/h8-10,18H,4-7H2,1-3H3,(H,15,16,17)/t8-,9?,10+,14?/m1/s1 |
| InChIKey | PMBVXYDUOGFLMR-LISWRGBSSA-N |
| XLogP | 1.92 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|