C18H19ClN2O2S — CID 136503094
2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-6'-chlorospiro[1,3-thiazolidine-5,4'-2,3-dihydrochromene]-4-one (PubChem CID 136503094) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-6'-chlorospiro[1,3-thiazolidine-5,4'-2,3-dihydrochromene]-4-one.
| Compound Name | 2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-6'-chlorospiro[1,3-thiazolidine-5,4'-2,3-dihydrochromene]-4-one |
|---|---|
| PubChem CID | 136503094 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-[[(2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-6'-chlorospiro[1,3-thiazolidine-5,4'-2,3-dihydrochromene]-4-one |
| SMILES | O=C1N/C(=N\[C@H]2C[C@@H]3CCC2C3)SC12CCOc1ccc(Cl)cc12 |
| InChI | InChI=1S/C18H19ClN2O2S/c19-12-3-4-15-13(9-12)18(5-6-23-15)16(22)21-17(24-18)20-14-8-10-1-2-11(14)7-10/h3-4,9-11,14H,1-2,5-8H2,(H,20,21,22)/t10-,11?,14+,18?/m1/s1 |
| InChIKey | NAHTZCPHGDPSJL-YMMLGLIDSA-N |
| XLogP | 3.73 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|