C24H25N3O4S — CID 136503328
(NZ)-N-[6-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine (PubChem CID 136503328) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is (NZ)-N-[6-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[6-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 136503328 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (NZ)-N-[6-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine |
| SMILES | CC1CN(CCOc2ccc3oc(-c4cc5sccc5cn4)c/c(=N/O)c3c2)CC(C)O1 |
| InChI | InChI=1S/C24H25N3O4S/c1-15-13-27(14-16(2)30-15)6-7-29-18-3-4-22-19(9-18)20(26-28)10-23(31-22)21-11-24-17(12-25-21)5-8-32-24/h3-5,8-12,15-16,28H,6-7,13-14H2,1-2H3/b26-20- |
| InChIKey | OOVZRZJLKGEELH-QOMWVZHYSA-N |
| XLogP | 4.49 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|