C27H23N3O3S — CID 136503331
(NZ)-N-[6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine (PubChem CID 136503331) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is (NZ)-N-[6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 136503331 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (NZ)-N-[6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-2-thieno[3,2-c]pyridin-6-ylchromen-4-ylidene]hydroxylamine |
| SMILES | O/N=c1/cc(-c2cc3sccc3cn2)oc2ccc(OCCN3CCc4ccccc4C3)cc12 |
| InChI | InChI=1S/C27H23N3O3S/c31-29-23-14-26(24-15-27-19(16-28-24)8-12-34-27)33-25-6-5-21(13-22(23)25)32-11-10-30-9-7-18-3-1-2-4-20(18)17-30/h1-6,8,12-16,31H,7,9-11,17H2/b29-23- |
| InChIKey | SJGNLNNQOJOVNN-FAJYDZGRSA-N |
| XLogP | 5.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|