C18H21NO8S — CID 136503627
ethyl 3-[5-[3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-oxazol-5-yl)prop-2-enylidene]-2-methyl-4,6-dioxo-1,3-dioxan-2-yl]propanoate (PubChem CID 136503627) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is ethyl 3-[5-[3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-oxazol-5-yl)prop-2-enylidene]-2-methyl-4,6-dioxo-1,3-dioxan-2-yl]propanoate.
| Compound Name | ethyl 3-[5-[3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-oxazol-5-yl)prop-2-enylidene]-2-methyl-4,6-dioxo-1,3-dioxan-2-yl]propanoate |
|---|---|
| PubChem CID | 136503627 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 3-[5-[3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-oxazol-5-yl)prop-2-enylidene]-2-methyl-4,6-dioxo-1,3-dioxan-2-yl]propanoate |
| SMILES | CCOC(=O)CCC1(C)OC(=O)C(=CC=Cc2oc(=S)n(CC)c2O)C(=O)O1 |
| InChI | InChI=1S/C18H21NO8S/c1-4-19-14(21)12(25-17(19)28)8-6-7-11-15(22)26-18(3,27-16(11)23)10-9-13(20)24-5-2/h6-8,21H,4-5,9-10H2,1-3H3/b8-6?,11-7- |
| InChIKey | FCHZEOGRWGEWKG-RVICAJJDSA-N |
| XLogP | 2.64 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|