About Deoxy-methyl-cytosine
Deoxy-methyl-cytosine (PubChem CID 136503713) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 3-methyl-1,2-dihydropyrimidin-4-imine.
Molecular Properties
| Compound Name | Deoxy-methyl-cytosine |
| PubChem CID | 136503713 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 3-methyl-1,2-dihydropyrimidin-4-imine |
| SMILES | CN1CNC=CC1=N |
| InChI | InChI=1S/C5H9N3/c1-8-4-7-3-2-5(8)6/h2-3,6-7H,4H2,1H3 |
| InChIKey | UPZPJIPCOOTVON-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 39.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 128 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze Deoxy-methyl-cytosine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Deoxy-methyl-cytosine?
The IUPAC name of Deoxy-methyl-cytosine (CID 136503713) is 3-methyl-1,2-dihydropyrimidin-4-imine.
What is the SMILES notation for Deoxy-methyl-cytosine?
The canonical SMILES for Deoxy-methyl-cytosine is CN1CNC=CC1=N.
What is the InChIKey of Deoxy-methyl-cytosine?
The InChIKey is UPZPJIPCOOTVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-8-4-7-3-2-5(8)6/h2-3,6-7H,4H2,1H3.
What are the key properties of Deoxy-methyl-cytosine?
Deoxy-methyl-cytosine has a molecular weight of 111.15 g/mol, XLogP of -0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Deoxy-methyl-cytosine is sourced from PubChem (CID 136503713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).