About 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one
7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one (PubChem CID 136504145) has the molecular formula C26H16N2O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one.
Molecular Properties
| Compound Name | 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one |
| PubChem CID | 136504145 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one |
| SMILES | O=C1N=c2c(ccc3c2ccc2c(-c4ccccc4)c(O)[nH]c23)=C1c1ccccc1 |
| InChI | InChI=1S/C26H16N2O2/c29-25-21(15-7-3-1-4-8-15)19-13-11-18-17(23(19)27-25)12-14-20-22(26(30)28-24(18)20)16-9-5-2-6-10-16/h1-14,27,29H |
| InChIKey | INWUFEVAJRBUOC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one?
The IUPAC name of 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one (CID 136504145) is 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one.
What is the SMILES notation for 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one?
The canonical SMILES for 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one is O=C1N=c2c(ccc3c2ccc2c(-c4ccccc4)c(O)[nH]c23)=C1c1ccccc1.
What is the InChIKey of 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one?
The InChIKey is INWUFEVAJRBUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N2O2/c29-25-21(15-7-3-1-4-8-15)19-13-11-18-17(23(19)27-25)12-14-20-22(26(30)28-24(18)20)16-9-5-2-6-10-16/h1-14,27,29H.
What are the key properties of 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one?
7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one has a molecular weight of 388.43 g/mol, XLogP of 4.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1,6-diphenyl-8H-indolo[7,6-g]indol-2-one is sourced from PubChem (CID 136504145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).