C22H15FN4O3 — CID 136504146
N-[(E)-(6-fluoro-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide (PubChem CID 136504146) has the molecular formula C22H15FN4O3 and a molecular weight of 402.39 g/mol. Its IUPAC name is N-[(E)-(6-fluoro-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide.
| Compound Name | N-[(E)-(6-fluoro-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 136504146 |
| Molecular Formula | C22H15FN4O3 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[(E)-(6-fluoro-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide |
| SMILES | Cc1ccc2oc(=O)c3ccc(C(=O)N/N=C/c4c[nH]c5cc(F)ccc45)cc3n12 |
| InChI | InChI=1S/C22H15FN4O3/c1-12-2-7-20-27(12)19-8-13(3-5-17(19)22(29)30-20)21(28)26-25-11-14-10-24-18-9-15(23)4-6-16(14)18/h2-11,24H,1H3,(H,26,28)/b25-11+ |
| InChIKey | HJCCGVZZLWHJSQ-OPEKNORGSA-N |
| XLogP | 3.74 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|