C23H15N5O3 — CID 136504149
N-[(E)-(5-cyano-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide (PubChem CID 136504149) has the molecular formula C23H15N5O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[(E)-(5-cyano-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide.
| Compound Name | N-[(E)-(5-cyano-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 136504149 |
| Molecular Formula | C23H15N5O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[(E)-(5-cyano-1H-indol-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide |
| SMILES | Cc1ccc2oc(=O)c3ccc(C(=O)N/N=C/c4c[nH]c5ccc(C#N)cc45)cc3n12 |
| InChI | InChI=1S/C23H15N5O3/c1-13-2-7-21-28(13)20-9-15(4-5-17(20)23(30)31-21)22(29)27-26-12-16-11-25-19-6-3-14(10-24)8-18(16)19/h2-9,11-12,25H,1H3,(H,27,29)/b26-12+ |
| InChIKey | CKFUYWKSYCLCAL-RPPGKUMJSA-N |
| XLogP | 3.47 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|