C23H33N3O9 — CID 136504194
1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 136504194) has the molecular formula C23H33N3O9 and a molecular weight of 495.53 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 136504194 |
| Molecular Formula | C23H33N3O9 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C/C(=N\OCC(O)CNC(C)(C)C)c1c[nH]c2ccccc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H25N3O2.C6H8O7/c1-12(15-10-18-16-8-6-5-7-14(15)16)20-22-11-13(21)9-19-17(2,3)4;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-8,10,13,18-19,21H,9,11H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b20-12+; |
| InChIKey | ZSJLPYNNXRNIFC-BGDWDFROSA-N |
| XLogP | 1.41 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|