C28H31F3N5O3+ — CID 136504576
N'-(2-aminoethyl)-N-[1-oxo-1-(quinolin-3-ylamino)-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-N'-propylbutanediamide (PubChem CID 136504576) has the molecular formula C28H31F3N5O3+ and a molecular weight of 542.58 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N-[1-oxo-1-(quinolin-3-ylamino)-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-N'-propylbutanediamide.
| Compound Name | N'-(2-aminoethyl)-N-[1-oxo-1-(quinolin-3-ylamino)-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-N'-propylbutanediamide |
|---|---|
| PubChem CID | 136504576 |
| Molecular Formula | C28H31F3N5O3+ |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N'-(2-aminoethyl)-N-[1-oxo-1-(quinolin-3-ylamino)-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-N'-propylbutanediamide |
| SMILES | [CH2+]CCN(CCN)C(=O)CCC(=O)NC(Cc1ccc(C(F)(F)F)cc1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C28H30F3N5O3/c1-2-14-36(15-13-32)26(38)12-11-25(37)35-24(16-19-7-9-21(10-8-19)28(29,30)31)27(39)34-22-17-20-5-3-4-6-23(20)33-18-22/h3-10,17-18,24H,1-2,11-16,32H2,(H-,34,35,37,39)/p+1 |
| InChIKey | LBKLVBGTNIEGDN-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|