About 9-chloro-6H-pyrrolo[3,2-f]quinoline
9-chloro-6H-pyrrolo[3,2-f]quinoline (PubChem CID 136504623) has the molecular formula C11H7ClN2
and a molecular weight of 202.64 g/mol. Its IUPAC name is 9-chloro-6H-pyrrolo[3,2-f]quinoline.
Molecular Properties
| Compound Name | 9-chloro-6H-pyrrolo[3,2-f]quinoline |
| PubChem CID | 136504623 |
| Molecular Formula | C11H7ClN2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 9-chloro-6H-pyrrolo[3,2-f]quinoline |
| SMILES | Clc1cc[nH]c2ccc3nccc3c12 |
| InChI | InChI=1S/C11H7ClN2/c12-8-4-6-14-10-2-1-9-7(11(8)10)3-5-13-9/h1-6,14H |
| InChIKey | LEFGGWPSNPCYSW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-chloro-6H-pyrrolo[3,2-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-6H-pyrrolo[3,2-f]quinoline?
The IUPAC name of 9-chloro-6H-pyrrolo[3,2-f]quinoline (CID 136504623) is 9-chloro-6H-pyrrolo[3,2-f]quinoline.
What is the SMILES notation for 9-chloro-6H-pyrrolo[3,2-f]quinoline?
The canonical SMILES for 9-chloro-6H-pyrrolo[3,2-f]quinoline is Clc1cc[nH]c2ccc3nccc3c12.
What is the InChIKey of 9-chloro-6H-pyrrolo[3,2-f]quinoline?
The InChIKey is LEFGGWPSNPCYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN2/c12-8-4-6-14-10-2-1-9-7(11(8)10)3-5-13-9/h1-6,14H.
What are the key properties of 9-chloro-6H-pyrrolo[3,2-f]quinoline?
9-chloro-6H-pyrrolo[3,2-f]quinoline has a molecular weight of 202.64 g/mol, XLogP of 3.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-6H-pyrrolo[3,2-f]quinoline is sourced from PubChem (CID 136504623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).