C26H35N5O3 — CID 136505941
1-cyclopentyl-8-[(3R)-4-(3-methoxypropyl)-3-methylpiperazine-1-carbonyl]-7-methyl-5H-pyrazolo[4,5-c]quinolin-4-one (PubChem CID 136505941) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-cyclopentyl-8-[(3R)-4-(3-methoxypropyl)-3-methylpiperazine-1-carbonyl]-7-methyl-5H-pyrazolo[4,5-c]quinolin-4-one.
| Compound Name | 1-cyclopentyl-8-[(3R)-4-(3-methoxypropyl)-3-methylpiperazine-1-carbonyl]-7-methyl-5H-pyrazolo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 136505941 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 1-cyclopentyl-8-[(3R)-4-(3-methoxypropyl)-3-methylpiperazine-1-carbonyl]-7-methyl-5H-pyrazolo[4,5-c]quinolin-4-one |
| SMILES | COCCCN1CCN(C(=O)c2cc3c(cc2C)[nH]c(=O)c2cnn(C4CCCC4)c23)C[C@H]1C |
| InChI | InChI=1S/C26H35N5O3/c1-17-13-23-21(24-22(25(32)28-23)15-27-31(24)19-7-4-5-8-19)14-20(17)26(33)30-11-10-29(18(2)16-30)9-6-12-34-3/h13-15,18-19H,4-12,16H2,1-3H3,(H,28,32)/t18-/m1/s1 |
| InChIKey | OJYMQXNYCGSHFL-GOSISDBHSA-N |
| XLogP | 3.48 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|