C21H24N2O6 — CID 136506479
4-[2-hydroxy-5-methyl-3-[(3,4,5-trimethoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid (PubChem CID 136506479) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 4-[2-hydroxy-5-methyl-3-[(3,4,5-trimethoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid.
| Compound Name | 4-[2-hydroxy-5-methyl-3-[(3,4,5-trimethoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 136506479 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[2-hydroxy-5-methyl-3-[(3,4,5-trimethoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid |
| SMILES | C=C(CCc1cc(C)cc(/N=N/c2cc(OC)c(OC)c(OC)c2)c1O)C(=O)O |
| InChI | InChI=1S/C21H24N2O6/c1-12-8-14(7-6-13(2)21(25)26)19(24)16(9-12)23-22-15-10-17(27-3)20(29-5)18(11-15)28-4/h8-11,24H,2,6-7H2,1,3-5H3,(H,25,26)/b23-22+ |
| InChIKey | BXGIQQZTZWZPEA-GHVJWSGMSA-N |
| XLogP | 4.72 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|