C27H28N4O5 — CID 136506816
3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)-2-[4-(2-methyltetrazol-5-yl)phenyl]chromen-4-one (PubChem CID 136506816) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)-2-[4-(2-methyltetrazol-5-yl)phenyl]chromen-4-one.
| Compound Name | 3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)-2-[4-(2-methyltetrazol-5-yl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 136506816 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3,5,7-trihydroxy-6,8-bis(3-methylbut-2-enyl)-2-[4-(2-methyltetrazol-5-yl)phenyl]chromen-4-one |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2oc(-c3ccc(-c4nnn(C)n4)cc3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C27H28N4O5/c1-14(2)6-12-18-21(32)19(13-7-15(3)4)26-20(22(18)33)23(34)24(35)25(36-26)16-8-10-17(11-9-16)27-28-30-31(5)29-27/h6-11,32-33,35H,12-13H2,1-5H3 |
| InChIKey | SLHVLVAMZJXUTD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|