C27H36N4O2 — CID 136507268
(5R)-5-cyclohexa-2,4-dien-1-yl-N-[3-[4-(hydroxymethyl)phenyl]pentan-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136507268) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (5R)-5-cyclohexa-2,4-dien-1-yl-N-[3-[4-(hydroxymethyl)phenyl]pentan-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R)-5-cyclohexa-2,4-dien-1-yl-N-[3-[4-(hydroxymethyl)phenyl]pentan-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136507268 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (5R)-5-cyclohexa-2,4-dien-1-yl-N-[3-[4-(hydroxymethyl)phenyl]pentan-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCC(CC)(NC(=O)c1cnn2c1N[C@@H](C1C=CC=CC1)CC2(C)C)c1ccc(CO)cc1 |
| InChI | InChI=1S/C27H36N4O2/c1-5-27(6-2,21-14-12-19(18-32)13-15-21)30-25(33)22-17-28-31-24(22)29-23(16-26(31,3)4)20-10-8-7-9-11-20/h7-10,12-15,17,20,23,29,32H,5-6,11,16,18H2,1-4H3,(H,30,33)/t20?,23-/m1/s1 |
| InChIKey | CCULYFLGUJHGQK-GWQXNCQPSA-N |
| XLogP | 4.87 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |