C24H35FN4O — CID 136507270
[(5R)-5-cyclohexa-2,4-dien-1-yl-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone (PubChem CID 136507270) has the molecular formula C24H35FN4O and a molecular weight of 414.57 g/mol. Its IUPAC name is [(5R)-5-cyclohexa-2,4-dien-1-yl-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone.
| Compound Name | [(5R)-5-cyclohexa-2,4-dien-1-yl-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 136507270 |
| Molecular Formula | C24H35FN4O |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | [(5R)-5-cyclohexa-2,4-dien-1-yl-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone |
| SMILES | CCC1(CC)CC(F)CN1C(=O)c1c(C)nn2c1N[C@@H](C1C=CC=CC1)CC2(C)C |
| InChI | InChI=1S/C24H35FN4O/c1-6-24(7-2)13-18(25)15-28(24)22(30)20-16(3)27-29-21(20)26-19(14-23(29,4)5)17-11-9-8-10-12-17/h8-11,17-19,26H,6-7,12-15H2,1-5H3/t17?,18?,19-/m1/s1 |
| InChIKey | WJRFKEIAKGDURG-CTWPCTMYSA-N |
| XLogP | 4.99 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |