C24H38N4O — CID 136507289
(5R)-5-cyclohexa-2,4-dien-1-yl-N-(3-ethylhexan-3-yl)-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136507289) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is (5R)-5-cyclohexa-2,4-dien-1-yl-N-(3-ethylhexan-3-yl)-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R)-5-cyclohexa-2,4-dien-1-yl-N-(3-ethylhexan-3-yl)-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136507289 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (5R)-5-cyclohexa-2,4-dien-1-yl-N-(3-ethylhexan-3-yl)-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCC(CC)(CC)NC(=O)c1c(C)nn2c1N[C@@H](C1C=CC=CC1)CC2(C)C |
| InChI | InChI=1S/C24H38N4O/c1-7-15-24(8-2,9-3)26-22(29)20-17(4)27-28-21(20)25-19(16-23(28,5)6)18-13-11-10-12-14-18/h10-13,18-19,25H,7-9,14-16H2,1-6H3,(H,26,29)/t18?,19-/m1/s1 |
| InChIKey | ZBCYZFVIVRSDQR-MUMRKEEXSA-N |
| XLogP | 5.33 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |