C23H33FN4O — CID 136507291
[(5R)-5-cyclohexa-2,4-dien-1-yl-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone (PubChem CID 136507291) has the molecular formula C23H33FN4O and a molecular weight of 400.54 g/mol. Its IUPAC name is [(5R)-5-cyclohexa-2,4-dien-1-yl-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone.
| Compound Name | [(5R)-5-cyclohexa-2,4-dien-1-yl-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 136507291 |
| Molecular Formula | C23H33FN4O |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(5R)-5-cyclohexa-2,4-dien-1-yl-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-(2,2-diethyl-4-fluoropyrrolidin-1-yl)methanone |
| SMILES | CCC1(CC)CC(F)CN1C(=O)c1cnn2c1N[C@@H](C1C=CC=CC1)CC2(C)C |
| InChI | InChI=1S/C23H33FN4O/c1-5-23(6-2)12-17(24)15-27(23)21(29)18-14-25-28-20(18)26-19(13-22(28,3)4)16-10-8-7-9-11-16/h7-10,14,16-17,19,26H,5-6,11-13,15H2,1-4H3/t16?,17?,19-/m1/s1 |
| InChIKey | JBDDQCXSULMRMY-FAFZWHIHSA-N |
| XLogP | 4.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |