C32H32N12O2 — CID 136507445
2-[(2-aminophenyl)diazenyl]-6-[[4-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylanilino]-6-(propylamino)-1,3,5-triazin-2-yl]amino]-4-methylphenol (PubChem CID 136507445) has the molecular formula C32H32N12O2 and a molecular weight of 616.69 g/mol. Its IUPAC name is 2-[(2-aminophenyl)diazenyl]-6-[[4-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylanilino]-6-(propylamino)-1,3,5-triazin-2-yl]amino]-4-methylphenol.
| Compound Name | 2-[(2-aminophenyl)diazenyl]-6-[[4-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylanilino]-6-(propylamino)-1,3,5-triazin-2-yl]amino]-4-methylphenol |
|---|---|
| PubChem CID | 136507445 |
| Molecular Formula | C32H32N12O2 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 2-[(2-aminophenyl)diazenyl]-6-[[4-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylanilino]-6-(propylamino)-1,3,5-triazin-2-yl]amino]-4-methylphenol |
| SMILES | CCCNc1nc(Nc2cc(C)cc(/N=N/c3ccccc3N)c2O)nc(Nc2cc(C)cc(-n3nc4ccccc4n3)c2O)n1 |
| InChI | InChI=1S/C32H32N12O2/c1-4-13-34-30-37-31(35-24-14-18(2)16-26(28(24)45)41-40-21-10-6-5-9-20(21)33)39-32(38-30)36-25-15-19(3)17-27(29(25)46)44-42-22-11-7-8-12-23(22)43-44/h5-12,14-17,45-46H,4,13,33H2,1-3H3,(H3,34,35,36,37,38,39)/b41-40+ |
| InChIKey | PBCUWPORAZGJLT-CDJCAARLSA-N |
| XLogP | 6.94 |
| TPSA | 196.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|