C22H20FN3O3S — CID 136507759
7-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-fluorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136507759) has the molecular formula C22H20FN3O3S and a molecular weight of 425.49 g/mol. Its IUPAC name is 7-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-fluorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-fluorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136507759 |
| Molecular Formula | C22H20FN3O3S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 7-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-fluorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(F)cc2)nc2c1CCN(S(=O)(=O)c1ccc3c(c1)CCC3)C2 |
| InChI | InChI=1S/C22H20FN3O3S/c23-17-7-4-15(5-8-17)21-24-20-13-26(11-10-19(20)22(27)25-21)30(28,29)18-9-6-14-2-1-3-16(14)12-18/h4-9,12H,1-3,10-11,13H2,(H,24,25,27) |
| InChIKey | IKLALUBBIAYQPR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |