C25H15Cl2N7O4S — CID 136508590
4-[[4-[(7,8-dichloro-4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 136508590) has the molecular formula C25H15Cl2N7O4S and a molecular weight of 580.41 g/mol. Its IUPAC name is 4-[[4-[(7,8-dichloro-4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[(7,8-dichloro-4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136508590 |
| Molecular Formula | C25H15Cl2N7O4S |
| Molecular Weight | 580.41 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | 4-[[4-[(7,8-dichloro-4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1c(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2)c(=O)n2c([nH]c3cc(Cl)c(Cl)cc32)c1C#N |
| InChI | InChI=1S/C25H15Cl2N7O4S/c1-13-18(12-28)24-29-21-10-19(26)20(27)11-22(21)34(24)25(35)23(13)33-32-15-4-2-14(3-5-15)30-31-16-6-8-17(9-7-16)39(36,37)38/h2-11,29H,1H3,(H,36,37,38)/b31-30+,33-32+ |
| InChIKey | GQEUNOXYRZZRQG-CJQWSLHQSA-N |
| XLogP | 7.35 |
| TPSA | 164.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.41 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|