C16H12F3N7O5S3 — CID 136508961
(6R,7S)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 136508961) has the molecular formula C16H12F3N7O5S3 and a molecular weight of 535.51 g/mol. Its IUPAC name is (6R,7S)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 136508961 |
| Molecular Formula | C16H12F3N7O5S3 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | (6R,7S)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]sulfanyl]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(/C(=N/O)C(=O)N[C@@H]2C(=O)N3C(C(=O)O)=C(Sc4ncc(C(F)(F)F)s4)CC[C@H]23)ns1 |
| InChI | InChI=1S/C16H12F3N7O5S3/c17-16(18,19)6-3-21-15(33-6)32-5-2-1-4-7(12(28)26(4)9(5)13(29)30)22-11(27)8(24-31)10-23-14(20)34-25-10/h3-4,7,31H,1-2H2,(H,22,27)(H,29,30)(H2,20,23,25)/b24-8-/t4-,7+/m1/s1 |
| InChIKey | AVSUTXVPAYMNOQ-UZUMLJCSSA-N |
| XLogP | 1.35 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|