C14H19Cl2N5O3 — CID 136509854
N-hydroxy-4-[2-[(4-methoxyphenyl)methyl-methylamino]ethylamino]-1,2,5-oxadiazole-3-carboximidoyl chloride;hydrochloride (PubChem CID 136509854) has the molecular formula C14H19Cl2N5O3 and a molecular weight of 376.24 g/mol. Its IUPAC name is N-hydroxy-4-[2-[(4-methoxyphenyl)methyl-methylamino]ethylamino]-1,2,5-oxadiazole-3-carboximidoyl chloride;hydrochloride.
| Compound Name | N-hydroxy-4-[2-[(4-methoxyphenyl)methyl-methylamino]ethylamino]-1,2,5-oxadiazole-3-carboximidoyl chloride;hydrochloride |
|---|---|
| PubChem CID | 136509854 |
| Molecular Formula | C14H19Cl2N5O3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-hydroxy-4-[2-[(4-methoxyphenyl)methyl-methylamino]ethylamino]-1,2,5-oxadiazole-3-carboximidoyl chloride;hydrochloride |
| SMILES | COc1ccc(CN(C)CCNc2nonc2C(Cl)=NO)cc1.Cl |
| InChI | InChI=1S/C14H18ClN5O3.ClH/c1-20(9-10-3-5-11(22-2)6-4-10)8-7-16-14-12(13(15)17-21)18-23-19-14;/h3-6,21H,7-9H2,1-2H3,(H,16,19);1H |
| InChIKey | ZVBIFOMUEWLYPT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|