About 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one
5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one (PubChem CID 136510063) has the molecular formula C15H11F2N3O2S
and a molecular weight of 335.33 g/mol. Its IUPAC name is 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one |
| PubChem CID | 136510063 |
| Molecular Formula | C15H11F2N3O2S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one |
| SMILES | Nc1c(-c2ccco2)nc(SCc2cccc(F)c2F)[nH]c1=O |
| InChI | InChI=1S/C15H11F2N3O2S/c16-9-4-1-3-8(11(9)17)7-23-15-19-13(10-5-2-6-22-10)12(18)14(21)20-15/h1-6H,7,18H2,(H,19,20,21) |
| InChIKey | PBNAQVBCJSEDSK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one (CID 136510063) is 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one is Nc1c(-c2ccco2)nc(SCc2cccc(F)c2F)[nH]c1=O.
What is the InChIKey of 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one?
The InChIKey is PBNAQVBCJSEDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3O2S/c16-9-4-1-3-8(11(9)17)7-23-15-19-13(10-5-2-6-22-10)12(18)14(21)20-15/h1-6H,7,18H2,(H,19,20,21).
What are the key properties of 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one?
5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one has a molecular weight of 335.33 g/mol, XLogP of 3.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[(2,3-difluorophenyl)methylsulfanyl]-4-(furan-2-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136510063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).