About 3H-1,4-benzodiazepin-8-ol
3H-1,4-benzodiazepin-8-ol (PubChem CID 136510488) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 3H-1,4-benzodiazepin-8-ol.
Molecular Properties
| Compound Name | 3H-1,4-benzodiazepin-8-ol |
| PubChem CID | 136510488 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 3H-1,4-benzodiazepin-8-ol |
| SMILES | Oc1ccc2c(c1)N=CCN=C2 |
| InChI | InChI=1S/C9H8N2O/c12-8-2-1-7-6-10-3-4-11-9(7)5-8/h1-2,4-6,12H,3H2 |
| InChIKey | RTVFTURSIYDTBA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-1,4-benzodiazepin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,4-benzodiazepin-8-ol?
The IUPAC name of 3H-1,4-benzodiazepin-8-ol (CID 136510488) is 3H-1,4-benzodiazepin-8-ol.
What is the SMILES notation for 3H-1,4-benzodiazepin-8-ol?
The canonical SMILES for 3H-1,4-benzodiazepin-8-ol is Oc1ccc2c(c1)N=CCN=C2.
What is the InChIKey of 3H-1,4-benzodiazepin-8-ol?
The InChIKey is RTVFTURSIYDTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-8-2-1-7-6-10-3-4-11-9(7)5-8/h1-2,4-6,12H,3H2.
What are the key properties of 3H-1,4-benzodiazepin-8-ol?
3H-1,4-benzodiazepin-8-ol has a molecular weight of 160.18 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,4-benzodiazepin-8-ol is sourced from PubChem (CID 136510488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).