C25H21FN4O5 — CID 136510632
3-[3-[(2Z)-2-[(3Z)-3-(2,3-dihydro-1-benzofuran-5-ylhydrazinylidene)-1-oxobutan-2-ylidene]hydrazinyl]-5-fluoro-2-hydroxyphenyl]benzoic acid (PubChem CID 136510632) has the molecular formula C25H21FN4O5 and a molecular weight of 476.46 g/mol. Its IUPAC name is 3-[3-[(2Z)-2-[(3Z)-3-(2,3-dihydro-1-benzofuran-5-ylhydrazinylidene)-1-oxobutan-2-ylidene]hydrazinyl]-5-fluoro-2-hydroxyphenyl]benzoic acid.
| Compound Name | 3-[3-[(2Z)-2-[(3Z)-3-(2,3-dihydro-1-benzofuran-5-ylhydrazinylidene)-1-oxobutan-2-ylidene]hydrazinyl]-5-fluoro-2-hydroxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 136510632 |
| Molecular Formula | C25H21FN4O5 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 3-[3-[(2Z)-2-[(3Z)-3-(2,3-dihydro-1-benzofuran-5-ylhydrazinylidene)-1-oxobutan-2-ylidene]hydrazinyl]-5-fluoro-2-hydroxyphenyl]benzoic acid |
| SMILES | CC(=N/Nc1ccc2c(c1)CCO2)/C(C=O)=N/Nc1cc(F)cc(-c2cccc(C(=O)O)c2)c1O |
| InChI | InChI=1S/C25H21FN4O5/c1-14(27-28-19-5-6-23-16(10-19)7-8-35-23)22(13-31)30-29-21-12-18(26)11-20(24(21)32)15-3-2-4-17(9-15)25(33)34/h2-6,9-13,28-29,32H,7-8H2,1H3,(H,33,34)/b27-14-,30-22+ |
| InChIKey | GWCPOKFTKXBIKW-PGYOGGQPSA-N |
| XLogP | 4.29 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|