About 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide
2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide (PubChem CID 136511678) has the molecular formula C20H26N4O
and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide.
Molecular Properties
| Compound Name | 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide |
| PubChem CID | 136511678 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide |
| SMILES | Cc1nc(C)c(C)c(N2CCC(NC(=O)c3ccccc3C)CC2)n1 |
| InChI | InChI=1S/C20H26N4O/c1-13-7-5-6-8-18(13)20(25)23-17-9-11-24(12-10-17)19-14(2)15(3)21-16(4)22-19/h5-8,17H,9-12H2,1-4H3,(H,23,25) |
| InChIKey | HUKVWNUMXCZMKA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide?
The IUPAC name of 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide (CID 136511678) is 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide.
What is the SMILES notation for 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide?
The canonical SMILES for 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide is Cc1nc(C)c(C)c(N2CCC(NC(=O)c3ccccc3C)CC2)n1.
What is the InChIKey of 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide?
The InChIKey is HUKVWNUMXCZMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O/c1-13-7-5-6-8-18(13)20(25)23-17-9-11-24(12-10-17)19-14(2)15(3)21-16(4)22-19/h5-8,17H,9-12H2,1-4H3,(H,23,25).
What are the key properties of 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide?
2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide has a molecular weight of 338.45 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-yl]benzamide is sourced from PubChem (CID 136511678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).