C17H23ClN2O3S — CID 136511944
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(methylsulfonylmethyl)cyclopropyl]ethanone (PubChem CID 136511944) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(methylsulfonylmethyl)cyclopropyl]ethanone.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(methylsulfonylmethyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 136511944 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(methylsulfonylmethyl)cyclopropyl]ethanone |
| SMILES | CS(=O)(=O)CC1(CC(=O)N2CCN(c3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C17H23ClN2O3S/c1-24(22,23)13-17(5-6-17)12-16(21)20-9-7-19(8-10-20)15-4-2-3-14(18)11-15/h2-4,11H,5-10,12-13H2,1H3 |
| InChIKey | PAYTWIUAPKYRTC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |