About 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide
5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide (PubChem CID 136513753) has the molecular formula C11H13BrN2O3S2
and a molecular weight of 365.27 g/mol. Its IUPAC name is 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide |
| PubChem CID | 136513753 |
| Molecular Formula | C11H13BrN2O3S2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide |
| SMILES | Cc1ccc(CN(C)S(=O)(=O)c2nc(C)c(Br)s2)o1 |
| InChI | InChI=1S/C11H13BrN2O3S2/c1-7-4-5-9(17-7)6-14(3)19(15,16)11-13-8(2)10(12)18-11/h4-5H,6H2,1-3H3 |
| InChIKey | QEYMLCJRBXRFCV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide?
The IUPAC name of 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide (CID 136513753) is 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide.
What is the SMILES notation for 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide?
The canonical SMILES for 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide is Cc1ccc(CN(C)S(=O)(=O)c2nc(C)c(Br)s2)o1.
What is the InChIKey of 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide?
The InChIKey is QEYMLCJRBXRFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2O3S2/c1-7-4-5-9(17-7)6-14(3)19(15,16)11-13-8(2)10(12)18-11/h4-5H,6H2,1-3H3.
What are the key properties of 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide?
5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide has a molecular weight of 365.27 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,4-dimethyl-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2-sulfonamide is sourced from PubChem (CID 136513753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).